FENDL-2 BENCHMARKS SUBLIBRARY
The directory BENCHMARKS/ contains descriptions, specifications and data
of experimental and calculational benchmarks for testing nuclear data for shielding-,
breeding/multiplication-, and other materials of potential importance for fusion design
application, provided by the international community of benchmark specialists.
Directory structure:
BENCHMARKS/
|
|------ACTIVATION/ (Activation Benchmark Data of
| the USDOE/JAERI collaboration)
|
|------BOMBAY/ (Neutron Multiplication Measurements in beryllium,
| beryllium oxide and lead with 14-MeV neutrons)
|
|------DRESDEN/
| |
| |-------FESLAB/ (TUD Iron Slab Benchmark)
| |
| |-------Pb/ (TUD Lead Sphere Benchmark)
|
|
|------ENEACEA/ (Irradiation of a stainless steel (SS) block by 14-MeV neutrons.
| Experiment carried out at FNG (Frascati neutron Generator))
|
|-----JAERIM94014/
| |
| |------Be/ (Integral Experiment on Beryllium Cylindrical Assembly)
| |
| |------C/ (Integral Experiment on Graphite Cylindrical Assembly)
| |
| |------COPPER/ (Integral Experiment on Copper Cylindrical Assembly)
| |
| |------FNS-TOF/
| | |
| | |-------BE/ (TOF experiment on Beryllium Slabs)
| | |
| | |-------C/ (TOF experiment on Graphite Slabs)
| | |
| | |-------Li2O/ (TOF experiment on Lithium Oxide Slabs)
| | |
| | |-------FE/ (TOF Experiment on Iron Slabs)
| | |
| | |-------LQ-N/ (TOF Experiment on Liquid Nitrogen Slabs)
| | |
| | |-------LQ-O/ (TOF Experiment on Liquid Oxygen Slabs)
| | |
| | |-------PB/ (TOF Experiment on Lead Slabs)
| |
| |-------IRON/
| | |
| | |-------FOIL/
| | |
| | |-------NE213/
| |
| |-------LI20/ (Integral Experiment on Lithium-dioxide Cylindrical Assembly)
| |
| |------OKTAVIAN/
| | |
| | |-------BELI/ (Leakage Neutron Spectra from Beryllium Sphere and
| | | Beryllium-Lithium Sphere)
| | |
| | |-------TBR/ (Tritium Breeding Ratio in Li, Pb-Li, Pb-Li-C, Be-Li,
| | | Be-Li-C, Spheres Measured with Li2CO3 Pellets and/or LiF TLDs)
| | |
| | |-------N-LEAK/ (Leakage Neutron Spectra from Various Sphere Piles with
| | | 14 MeV Neutrons)
| | |
| | |-------G-LEAK/ (Leakage Gamma Spectra from Various Sphere Piles with
| | 14 MeV neutrons)
| |
| |------SS316L/ (Fast Neutron Spectrum amd Secondary Gamma-Ray Heating in a
| Type 316L Stainless Steel Assembly Irradiated by 14 MeV Neutrons)
|
|----OKTAVIANFENI/ (TOF Experiments on Iron and Nickel Spheres
| at OKTAVIAN/Osaka University)
|
|-------RUSSIA
| |
| |-------OBNINSK/ (Neutron leakage spectra from Be, Fe, Pb,
| | PbLi Shells with 14 MeV Neutron Source)
| |
| |-------MOSCOW/ (Benchmark-experiments and analyses on streaming
| of 14-MeV neutrons in Iron and Iron-water radiation
| shielding mock-ups with slits)
|
|------WISCONSIN/ (Calculational benchmarks on neutronics and shielding and on
activation problems, which represent the steel/water
shielding blanket design in the ITER outline design, as well
as the responses to be calculated)
![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}